C18H22F3NO3S — CID 119241234
3-[[3-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 119241234) has the molecular formula C18H22F3NO3S and a molecular weight of 389.44 g/mol. Its IUPAC name is 3-[[3-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 119241234 |
| Molecular Formula | C18H22F3NO3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-[[3-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(NC(=O)C2CCCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C18H22F3NO3S/c19-18(20,21)14-5-2-4-13(10-14)17(25)22-15-6-1-3-12(9-15)11-26-8-7-16(23)24/h1,3,6,9,13-14H,2,4-5,7-8,10-11H2,(H,22,25)(H,23,24) |
| InChIKey | JZSKSWIPEMVFFQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|