C16H17F6NO — CID 55773022
N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 55773022) has the molecular formula C16H17F6NO and a molecular weight of 353.31 g/mol. Its IUPAC name is N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55773022 |
| Molecular Formula | C16H17F6NO |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCC(C(F)(F)F)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H17F6NO/c1-9-5-6-12(8-13(9)16(20,21)22)23-14(24)10-3-2-4-11(7-10)15(17,18)19/h5-6,8,10-11H,2-4,7H2,1H3,(H,23,24) |
| InChIKey | KDTGXUPSRUGLPL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |