C13H17ClF3N3O — CID 119515799
N-(6-amino-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119515799) has the molecular formula C13H17ClF3N3O and a molecular weight of 323.75 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119515799 |
| Molecular Formula | C13H17ClF3N3O |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc(NC(=O)C2CCCC(C(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C13H16F3N3O.ClH/c14-13(15,16)9-3-1-2-8(6-9)12(20)19-10-4-5-11(17)18-7-10;/h4-5,7-9H,1-3,6H2,(H2,17,18)(H,19,20);1H |
| InChIKey | RDGJWUHYCMBYPB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |