C13H13F5N2O — CID 103097942
N-(2,6-difluoro-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 103097942) has the molecular formula C13H13F5N2O and a molecular weight of 308.25 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 103097942 |
| Molecular Formula | C13H13F5N2O |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)nc1F)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H13F5N2O/c14-10-5-4-9(11(15)20-10)19-12(21)7-2-1-3-8(6-7)13(16,17)18/h4-5,7-8H,1-3,6H2,(H,19,21) |
| InChIKey | LOGDVUTWYFTMNJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|