C15H17ClF3NO — CID 46485912
N-(3-chloro-2-methylphenyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 46485912) has the molecular formula C15H17ClF3NO and a molecular weight of 319.75 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 46485912 |
| Molecular Formula | C15H17ClF3NO |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H17ClF3NO/c1-9-12(16)6-3-7-13(9)20-14(21)10-4-2-5-11(8-10)15(17,18)19/h3,6-7,10-11H,2,4-5,8H2,1H3,(H,20,21) |
| InChIKey | IBXYXPKYLQRLBF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |