C17H17BrF3N3O — CID 55777756
N-[2-(4-bromopyrazol-1-yl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 55777756) has the molecular formula C17H17BrF3N3O and a molecular weight of 416.24 g/mol. Its IUPAC name is N-[2-(4-bromopyrazol-1-yl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[2-(4-bromopyrazol-1-yl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55777756 |
| Molecular Formula | C17H17BrF3N3O |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[2-(4-bromopyrazol-1-yl)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1-n1cc(Br)cn1)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H17BrF3N3O/c18-13-9-22-24(10-13)15-7-2-1-6-14(15)23-16(25)11-4-3-5-12(8-11)17(19,20)21/h1-2,6-7,9-12H,3-5,8H2,(H,23,25) |
| InChIKey | LWHMFHMJSTUNDW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |