About N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide
N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide (PubChem CID 86998596) has the molecular formula C14H14BrN3OS2
and a molecular weight of 384.32 g/mol. Its IUPAC name is N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide |
| PubChem CID | 86998596 |
| Molecular Formula | C14H14BrN3OS2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-n1cc(Br)cn1)C1CSCCS1 |
| InChI | InChI=1S/C14H14BrN3OS2/c15-10-7-16-18(8-10)12-4-2-1-3-11(12)17-14(19)13-9-20-5-6-21-13/h1-4,7-8,13H,5-6,9H2,(H,17,19) |
| InChIKey | QMSILJIJFNNYOK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide?
The IUPAC name of N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide (CID 86998596) is N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide.
What is the SMILES notation for N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide?
The canonical SMILES for N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide is O=C(Nc1ccccc1-n1cc(Br)cn1)C1CSCCS1.
What is the InChIKey of N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide?
The InChIKey is QMSILJIJFNNYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN3OS2/c15-10-7-16-18(8-10)12-4-2-1-3-11(12)17-14(19)13-9-20-5-6-21-13/h1-4,7-8,13H,5-6,9H2,(H,17,19).
What are the key properties of N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide?
N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide has a molecular weight of 384.32 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide is sourced from PubChem (CID 86998596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).