C14H14BrN3OS2 — CID 86998596
N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide (PubChem CID 86998596) has the molecular formula C14H14BrN3OS2 and a molecular weight of 384.32 g/mol. Its IUPAC name is N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide.
| Compound Name | N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 86998596 |
| Molecular Formula | C14H14BrN3OS2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-[2-(4-bromopyrazol-1-yl)phenyl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-n1cc(Br)cn1)C1CSCCS1 |
| InChI | InChI=1S/C14H14BrN3OS2/c15-10-7-16-18(8-10)12-4-2-1-3-11(12)17-14(19)13-9-20-5-6-21-13/h1-4,7-8,13H,5-6,9H2,(H,17,19) |
| InChIKey | QMSILJIJFNNYOK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |