C14H9Br2N3OS — CID 55764806
3-bromo-N-[2-(4-bromopyrazol-1-yl)phenyl]thiophene-2-carboxamide (PubChem CID 55764806) has the molecular formula C14H9Br2N3OS and a molecular weight of 427.12 g/mol. Its IUPAC name is 3-bromo-N-[2-(4-bromopyrazol-1-yl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(4-bromopyrazol-1-yl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55764806 |
| Molecular Formula | C14H9Br2N3OS |
| Molecular Weight | 427.12 g/mol |
| Exact Mass | 424.88 |
| IUPAC Name | 3-bromo-N-[2-(4-bromopyrazol-1-yl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-n1cc(Br)cn1)c1sccc1Br |
| InChI | InChI=1S/C14H9Br2N3OS/c15-9-7-17-19(8-9)12-4-2-1-3-11(12)18-14(20)13-10(16)5-6-21-13/h1-8H,(H,18,20) |
| InChIKey | IUXFOYZXNASODY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.12 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |