C18H23ClF3NO3 — CID 86863737
N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 86863737) has the molecular formula C18H23ClF3NO3 and a molecular weight of 393.83 g/mol. Its IUPAC name is N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86863737 |
| Molecular Formula | C18H23ClF3NO3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CCOCCOc1c(Cl)cccc1NC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H23ClF3NO3/c1-2-25-9-10-26-16-14(19)7-4-8-15(16)23-17(24)12-5-3-6-13(11-12)18(20,21)22/h4,7-8,12-13H,2-3,5-6,9-11H2,1H3,(H,23,24) |
| InChIKey | AVNFLQKWZLQALK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|