C17H26Cl2N2O3 — CID 119773171
3-amino-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119773171) has the molecular formula C17H26Cl2N2O3 and a molecular weight of 377.31 g/mol. Its IUPAC name is 3-amino-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119773171 |
| Molecular Formula | C17H26Cl2N2O3 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-amino-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCOCCOc1ccc(Cl)cc1NC(=O)C1CCCC(N)C1.Cl |
| InChI | InChI=1S/C17H25ClN2O3.ClH/c1-2-22-8-9-23-16-7-6-13(18)11-15(16)20-17(21)12-4-3-5-14(19)10-12;/h6-7,11-12,14H,2-5,8-10,19H2,1H3,(H,20,21);1H |
| InChIKey | KULIIEAXZLJAJA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|