C15H21ClN2O3 — CID 124683819
(3R)-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]pyrrolidine-3-carboxamide (PubChem CID 124683819) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is (3R)-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124683819 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (3R)-N-[5-chloro-2-(2-ethoxyethoxy)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CCOCCOc1ccc(Cl)cc1NC(=O)[C@@H]1CCNC1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-2-20-7-8-21-14-4-3-12(16)9-13(14)18-15(19)11-5-6-17-10-11/h3-4,9,11,17H,2,5-8,10H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | HOZIQTKDWJXTRJ-LLVKDONJSA-N |
| XLogP | 2.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|