C13H14BrF3N2O — CID 106832051
N-(6-bromo-3-pyridinyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106832051) has the molecular formula C13H14BrF3N2O and a molecular weight of 351.17 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(6-bromo-3-pyridinyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106832051 |
| Molecular Formula | C13H14BrF3N2O |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)nc1)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H14BrF3N2O/c14-11-6-5-10(7-18-11)19-12(20)8-1-3-9(4-2-8)13(15,16)17/h5-9H,1-4H2,(H,19,20) |
| InChIKey | LZHWJJWBCONSTC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|