C14H16F4N2O — CID 107333937
N-(3-amino-5-fluorophenyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 107333937) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is N-(3-amino-5-fluorophenyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-amino-5-fluorophenyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107333937 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(3-amino-5-fluorophenyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | Nc1cc(F)cc(NC(=O)C2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C14H16F4N2O/c15-10-5-11(19)7-12(6-10)20-13(21)8-1-3-9(4-2-8)14(16,17)18/h5-9H,1-4,19H2,(H,20,21) |
| InChIKey | CBLNMNFUCDXXSB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|