C16H21F3N2O4S — CID 60509557
N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 60509557) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 60509557 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCCC(C(F)(F)F)C2)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C16H21F3N2O4S/c1-25-14-9-12(6-7-13(14)21-26(2,23)24)20-15(22)10-4-3-5-11(8-10)16(17,18)19/h6-7,9-11,21H,3-5,8H2,1-2H3,(H,20,22) |
| InChIKey | MXLOEMIXHWNUOT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |