C10H11BrF2N2O4S — CID 51132083
2-bromo-2,2-difluoro-N-[4-(methanesulfonamido)-3-methoxyphenyl]acetamide (PubChem CID 51132083) has the molecular formula C10H11BrF2N2O4S and a molecular weight of 373.18 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-N-[4-(methanesulfonamido)-3-methoxyphenyl]acetamide.
| Compound Name | 2-bromo-2,2-difluoro-N-[4-(methanesulfonamido)-3-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 51132083 |
| Molecular Formula | C10H11BrF2N2O4S |
| Molecular Weight | 373.18 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 2-bromo-2,2-difluoro-N-[4-(methanesulfonamido)-3-methoxyphenyl]acetamide |
| SMILES | COc1cc(NC(=O)C(F)(F)Br)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C10H11BrF2N2O4S/c1-19-8-5-6(14-9(16)10(11,12)13)3-4-7(8)15-20(2,17)18/h3-5,15H,1-2H3,(H,14,16) |
| InChIKey | VKOWPGCWHASEBL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|