C12H19N3O5S — CID 120985632
2-amino-N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-methoxypropanamide (PubChem CID 120985632) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-amino-N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-methoxypropanamide.
| Compound Name | 2-amino-N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 120985632 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-amino-N-[4-(methanesulfonamido)-3-methoxyphenyl]-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)Nc1ccc(NS(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C12H19N3O5S/c1-19-7-9(13)12(16)14-8-4-5-10(11(6-8)20-2)15-21(3,17)18/h4-6,9,15H,7,13H2,1-3H3,(H,14,16) |
| InChIKey | GTPCDKRUBUKSBZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |