C16H18F3NO5S — CID 119257846
3-methylsulfonyl-5-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid (PubChem CID 119257846) has the molecular formula C16H18F3NO5S and a molecular weight of 393.38 g/mol. Its IUPAC name is 3-methylsulfonyl-5-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid.
| Compound Name | 3-methylsulfonyl-5-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 119257846 |
| Molecular Formula | C16H18F3NO5S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-methylsulfonyl-5-[[3-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid |
| SMILES | CS(=O)(=O)c1cc(NC(=O)C2CCCC(C(F)(F)F)C2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H18F3NO5S/c1-26(24,25)13-7-10(15(22)23)6-12(8-13)20-14(21)9-3-2-4-11(5-9)16(17,18)19/h6-9,11H,2-5H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | FHJRPCQETUUKKI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |