C14H17NO6S — CID 154744948
3-[(3-methoxycyclobutanecarbonyl)amino]-5-methylsulfonylbenzoic acid (PubChem CID 154744948) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is 3-[(3-methoxycyclobutanecarbonyl)amino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[(3-methoxycyclobutanecarbonyl)amino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 154744948 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-[(3-methoxycyclobutanecarbonyl)amino]-5-methylsulfonylbenzoic acid |
| SMILES | COC1CC(C(=O)Nc2cc(C(=O)O)cc(S(C)(=O)=O)c2)C1 |
| InChI | InChI=1S/C14H17NO6S/c1-21-11-4-8(5-11)13(16)15-10-3-9(14(17)18)6-12(7-10)22(2,19)20/h3,6-8,11H,4-5H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | KWGUTQRTKCEYOJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |