C17H22N2O6S — CID 119257713
3-methylsulfonyl-5-[(1-propanoylpiperidine-2-carbonyl)amino]benzoic acid (PubChem CID 119257713) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-methylsulfonyl-5-[(1-propanoylpiperidine-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-methylsulfonyl-5-[(1-propanoylpiperidine-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 119257713 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-methylsulfonyl-5-[(1-propanoylpiperidine-2-carbonyl)amino]benzoic acid |
| SMILES | CCC(=O)N1CCCCC1C(=O)Nc1cc(C(=O)O)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H22N2O6S/c1-3-15(20)19-7-5-4-6-14(19)16(21)18-12-8-11(17(22)23)9-13(10-12)26(2,24)25/h8-10,14H,3-7H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | AALNPYXSVDVAQM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |