C18H24N2O4 — CID 119252262
3-[4-[(1-propanoylpiperidine-2-carbonyl)amino]phenyl]propanoic acid (PubChem CID 119252262) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[4-[(1-propanoylpiperidine-2-carbonyl)amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[(1-propanoylpiperidine-2-carbonyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 119252262 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-[4-[(1-propanoylpiperidine-2-carbonyl)amino]phenyl]propanoic acid |
| SMILES | CCC(=O)N1CCCCC1C(=O)Nc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-2-16(21)20-12-4-3-5-15(20)18(24)19-14-9-6-13(7-10-14)8-11-17(22)23/h6-7,9-10,15H,2-5,8,11-12H2,1H3,(H,19,24)(H,22,23) |
| InChIKey | PUTJMOYRNDPOEU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |