C17H25ClN2O3S — CID 119775578
methyl 3-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride (PubChem CID 119775578) has the molecular formula C17H25ClN2O3S and a molecular weight of 372.92 g/mol. Its IUPAC name is methyl 3-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119775578 |
| Molecular Formula | C17H25ClN2O3S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | methyl 3-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]propanoate;hydrochloride |
| SMILES | COC(=O)CCSCc1cccc(NC(=O)C2CCC(N)C2)c1.Cl |
| InChI | InChI=1S/C17H24N2O3S.ClH/c1-22-16(20)7-8-23-11-12-3-2-4-15(9-12)19-17(21)13-5-6-14(18)10-13;/h2-4,9,13-14H,5-8,10-11,18H2,1H3,(H,19,21);1H |
| InChIKey | FSABIBFVBYFPSO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|