C16H22N2O3S — CID 119775531
methyl 2-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]acetate (PubChem CID 119775531) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is methyl 2-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 119775531 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl 2-[[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCc1cccc(NC(=O)C2CCC(N)C2)c1 |
| InChI | InChI=1S/C16H22N2O3S/c1-21-15(19)10-22-9-11-3-2-4-14(7-11)18-16(20)12-5-6-13(17)8-12/h2-4,7,12-13H,5-6,8-10,17H2,1H3,(H,18,20) |
| InChIKey | CHTDWPDTTQBVHL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |