C16H23ClN2O3S — CID 119318862
methyl 2-[[3-(piperidine-3-carbonylamino)phenyl]methylsulfanyl]acetate;hydrochloride (PubChem CID 119318862) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is methyl 2-[[3-(piperidine-3-carbonylamino)phenyl]methylsulfanyl]acetate;hydrochloride.
| Compound Name | methyl 2-[[3-(piperidine-3-carbonylamino)phenyl]methylsulfanyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 119318862 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl 2-[[3-(piperidine-3-carbonylamino)phenyl]methylsulfanyl]acetate;hydrochloride |
| SMILES | COC(=O)CSCc1cccc(NC(=O)C2CCCNC2)c1.Cl |
| InChI | InChI=1S/C16H22N2O3S.ClH/c1-21-15(19)11-22-10-12-4-2-6-14(8-12)18-16(20)13-5-3-7-17-9-13;/h2,4,6,8,13,17H,3,5,7,9-11H2,1H3,(H,18,20);1H |
| InChIKey | XOGQLPIBNOHPNU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |