C19H29ClN2O2S — CID 119327223
N-[3-(cyclohexylsulfinylmethyl)phenyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119327223) has the molecular formula C19H29ClN2O2S and a molecular weight of 384.97 g/mol. Its IUPAC name is N-[3-(cyclohexylsulfinylmethyl)phenyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119327223 |
| Molecular Formula | C19H29ClN2O2S |
| Molecular Weight | 384.97 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(CS(=O)C2CCCCC2)c1)C1CCCNC1 |
| InChI | InChI=1S/C19H28N2O2S.ClH/c22-19(16-7-5-11-20-13-16)21-17-8-4-6-15(12-17)14-24(23)18-9-2-1-3-10-18;/h4,6,8,12,16,18,20H,1-3,5,7,9-11,13-14H2,(H,21,22);1H |
| InChIKey | BDFUYHDDZMCIPW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |