C16H21NO2S — CID 166405123
N-[3-(cyclohexylsulfinylmethyl)phenyl]prop-2-enamide (PubChem CID 166405123) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is N-[3-(cyclohexylsulfinylmethyl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166405123 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CS(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C16H21NO2S/c1-2-16(18)17-14-8-6-7-13(11-14)12-20(19)15-9-4-3-5-10-15/h2,6-8,11,15H,1,3-5,9-10,12H2,(H,17,18) |
| InChIKey | FUICLTGMGXROFD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|