C22H25NO3S — CID 91642928
N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-(4-methylphenyl)-2-oxoacetamide (PubChem CID 91642928) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-(4-methylphenyl)-2-oxoacetamide.
| Compound Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-(4-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 91642928 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-(4-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C(=O)C(=O)Nc2cccc(CS(=O)C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-16-10-12-18(13-11-16)21(24)22(25)23-19-7-5-6-17(14-19)15-27(26)20-8-3-2-4-9-20/h5-7,10-14,20H,2-4,8-9,15H2,1H3,(H,23,25) |
| InChIKey | AYQYKQHTTYGOMZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|