C22H24F3NO3S — CID 86963463
N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-[2-(trifluoromethyl)phenoxy]acetamide (PubChem CID 86963463) has the molecular formula C22H24F3NO3S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-[2-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-[2-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 86963463 |
| Molecular Formula | C22H24F3NO3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]-2-[2-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1C(F)(F)F)Nc1cccc(CS(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H24F3NO3S/c23-22(24,25)19-11-4-5-12-20(19)29-14-21(27)26-17-8-6-7-16(13-17)15-30(28)18-9-2-1-3-10-18/h4-8,11-13,18H,1-3,9-10,14-15H2,(H,26,27) |
| InChIKey | ICVMCTUHCVGJHD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |