C18H27ClN2O3S — CID 119789944
N-[3-(cyclohexylsulfinylmethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119789944) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is N-[3-(cyclohexylsulfinylmethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119789944 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[3-(cyclohexylsulfinylmethyl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(CS(=O)C2CCCCC2)c1)C1CC(O)CN1 |
| InChI | InChI=1S/C18H26N2O3S.ClH/c21-15-10-17(19-11-15)18(22)20-14-6-4-5-13(9-14)12-24(23)16-7-2-1-3-8-16;/h4-6,9,15-17,19,21H,1-3,7-8,10-12H2,(H,20,22);1H |
| InChIKey | VSHRMXHXZBJOMP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |