C20H25ClN2O2S — CID 119327157
N-[3-(benzylsulfinylmethyl)phenyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119327157) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is N-[3-(benzylsulfinylmethyl)phenyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(benzylsulfinylmethyl)phenyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119327157 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[3-(benzylsulfinylmethyl)phenyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(CS(=O)Cc2ccccc2)c1)C1CCCCN1 |
| InChI | InChI=1S/C20H24N2O2S.ClH/c23-20(19-11-4-5-12-21-19)22-18-10-6-9-17(13-18)15-25(24)14-16-7-2-1-3-8-16;/h1-3,6-10,13,19,21H,4-5,11-12,14-15H2,(H,22,23);1H |
| InChIKey | BOGZQNXXHWSRFH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |