C18H21ClN2O3S — CID 119320762
N-[3-(benzenesulfonylmethyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119320762) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is N-[3-(benzenesulfonylmethyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(benzenesulfonylmethyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119320762 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[3-(benzenesulfonylmethyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(CS(=O)(=O)c2ccccc2)c1)C1CCCN1 |
| InChI | InChI=1S/C18H20N2O3S.ClH/c21-18(17-10-5-11-19-17)20-15-7-4-6-14(12-15)13-24(22,23)16-8-2-1-3-9-16;/h1-4,6-9,12,17,19H,5,10-11,13H2,(H,20,21);1H |
| InChIKey | TYWRRZDEJDLBTA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |