C17H27Cl2N3O2 — CID 119892146
N-[3-(azepan-1-yl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119892146) has the molecular formula C17H27Cl2N3O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-(azepan-1-yl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119892146 |
| Molecular Formula | C17H27Cl2N3O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[3-(azepan-1-yl)phenyl]-4-hydroxypyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cccc(N2CCCCCC2)c1)C1CC(O)CN1 |
| InChI | InChI=1S/C17H25N3O2.2ClH/c21-15-11-16(18-12-15)17(22)19-13-6-5-7-14(10-13)20-8-3-1-2-4-9-20;;/h5-7,10,15-16,18,21H,1-4,8-9,11-12H2,(H,19,22);2*1H |
| InChIKey | RCXQLAWMKAJGOD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |