C11H14ClN3O4 — CID 119670749
4-hydroxy-N-(3-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119670749) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is 4-hydroxy-N-(3-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 4-hydroxy-N-(3-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119670749 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-hydroxy-N-(3-nitrophenyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc([N+](=O)[O-])c1)C1CC(O)CN1 |
| InChI | InChI=1S/C11H13N3O4.ClH/c15-9-5-10(12-6-9)11(16)13-7-2-1-3-8(4-7)14(17)18;/h1-4,9-10,12,15H,5-6H2,(H,13,16);1H |
| InChIKey | GWRUFMSIZHTNNK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|