C24H29NO4S — CID 86958714
4-(4-ethylphenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-4-oxobutanamide (PubChem CID 86958714) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-4-oxobutanamide.
| Compound Name | 4-(4-ethylphenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 86958714 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-(4-ethylphenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-4-oxobutanamide |
| SMILES | CCc1ccc(C(=O)CCC(=O)Nc2cccc(CS(=O)C3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C24H29NO4S/c1-2-18-6-8-20(9-7-18)23(26)10-11-24(27)25-21-5-3-4-19(16-21)17-30(28)22-12-14-29-15-13-22/h3-9,16,22H,2,10-15,17H2,1H3,(H,25,27) |
| InChIKey | RBCRVGNTPDQACR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |