C19H22ClNO3S2 — CID 86956783
3-(5-chlorothiophen-2-yl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide (PubChem CID 86956783) has the molecular formula C19H22ClNO3S2 and a molecular weight of 411.98 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 86956783 |
| Molecular Formula | C19H22ClNO3S2 |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)s1)Nc1cccc(CS(=O)C2CCOCC2)c1 |
| InChI | InChI=1S/C19H22ClNO3S2/c20-18-6-4-16(25-18)5-7-19(22)21-15-3-1-2-14(12-15)13-26(23)17-8-10-24-11-9-17/h1-4,6,12,17H,5,7-11,13H2,(H,21,22) |
| InChIKey | SOUYDTMKOUDEPH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |