C22H22FNO3S2 — CID 86956771
5-fluoro-3-methyl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 86956771) has the molecular formula C22H22FNO3S2 and a molecular weight of 431.55 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 5-fluoro-3-methyl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 86956771 |
| Molecular Formula | C22H22FNO3S2 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 5-fluoro-3-methyl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(CS(=O)C3CCOCC3)c2)sc2ccc(F)cc12 |
| InChI | InChI=1S/C22H22FNO3S2/c1-14-19-12-16(23)5-6-20(19)28-21(14)22(25)24-17-4-2-3-15(11-17)13-29(26)18-7-9-27-10-8-18/h2-6,11-12,18H,7-10,13H2,1H3,(H,24,25) |
| InChIKey | DIXNXRBPDIQVNQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |