C23H22FNO4S — CID 86956906
5-(2-fluorophenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]furan-2-carboxamide (PubChem CID 86956906) has the molecular formula C23H22FNO4S and a molecular weight of 427.50 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86956906 |
| Molecular Formula | C23H22FNO4S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(CS(=O)C2CCOCC2)c1)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C23H22FNO4S/c24-20-7-2-1-6-19(20)21-8-9-22(29-21)23(26)25-17-5-3-4-16(14-17)15-30(27)18-10-12-28-13-11-18/h1-9,14,18H,10-13,15H2,(H,25,26) |
| InChIKey | YGROILBHIXDVFP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |