C22H25F2NO4S — CID 86956755
3-[4-(difluoromethoxy)phenyl]-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide (PubChem CID 86956755) has the molecular formula C22H25F2NO4S and a molecular weight of 437.51 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 86956755 |
| Molecular Formula | C22H25F2NO4S |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(OC(F)F)cc1)Nc1cccc(CS(=O)C2CCOCC2)c1 |
| InChI | InChI=1S/C22H25F2NO4S/c23-22(24)29-19-7-4-16(5-8-19)6-9-21(26)25-18-3-1-2-17(14-18)15-30(27)20-10-12-28-13-11-20/h1-5,7-8,14,20,22H,6,9-13,15H2,(H,25,26) |
| InChIKey | QQCUSGPHDAVVTL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |