C24H25NO3S — CID 86956969
2-naphthalen-2-yl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]acetamide (PubChem CID 86956969) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]acetamide.
| Compound Name | 2-naphthalen-2-yl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86956969 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-naphthalen-2-yl-N-[3-(oxan-4-ylsulfinylmethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1cccc(CS(=O)C2CCOCC2)c1 |
| InChI | InChI=1S/C24H25NO3S/c26-24(16-18-8-9-20-5-1-2-6-21(20)14-18)25-22-7-3-4-19(15-22)17-29(27)23-10-12-28-13-11-23/h1-9,14-15,23H,10-13,16-17H2,(H,25,26) |
| InChIKey | OYYOGMWTEFIQBN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |