C13H16F2N2O3 — CID 86776784
1-[3-(difluoromethoxy)phenyl]-3-(oxan-4-yl)urea (PubChem CID 86776784) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 86776784 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-(oxan-4-yl)urea |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)NC1CCOCC1 |
| InChI | InChI=1S/C13H16F2N2O3/c14-12(15)20-11-3-1-2-10(8-11)17-13(18)16-9-4-6-19-7-5-9/h1-3,8-9,12H,4-7H2,(H2,16,17,18) |
| InChIKey | CUBPIQGZAKYAJE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |