C15H19F2N3O4 — CID 56823494
methyl 3-[[3-(difluoromethoxy)phenyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 56823494) has the molecular formula C15H19F2N3O4 and a molecular weight of 343.33 g/mol. Its IUPAC name is methyl 3-[[3-(difluoromethoxy)phenyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | methyl 3-[[3-(difluoromethoxy)phenyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56823494 |
| Molecular Formula | C15H19F2N3O4 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl 3-[[3-(difluoromethoxy)phenyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(NC(=O)Nc2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C15H19F2N3O4/c1-23-15(22)20-7-3-5-11(9-20)19-14(21)18-10-4-2-6-12(8-10)24-13(16)17/h2,4,6,8,11,13H,3,5,7,9H2,1H3,(H2,18,19,21) |
| InChIKey | WFNABVXCBJWBOB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |