C17H20F2N2O4 — CID 90567994
N-[3-(difluoromethoxy)phenyl]-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 90567994) has the molecular formula C17H20F2N2O4 and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90567994 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)C1CC(=O)N(C2CCOCC2)C1 |
| InChI | InChI=1S/C17H20F2N2O4/c18-17(19)25-14-3-1-2-12(9-14)20-16(23)11-8-15(22)21(10-11)13-4-6-24-7-5-13/h1-3,9,11,13,17H,4-8,10H2,(H,20,23) |
| InChIKey | PGZSHXRPDVRBQX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |