C14H16F2N2O4S — CID 71785615
1-cyclopropylsulfonyl-N-[3-(difluoromethoxy)phenyl]azetidine-3-carboxamide (PubChem CID 71785615) has the molecular formula C14H16F2N2O4S and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-N-[3-(difluoromethoxy)phenyl]azetidine-3-carboxamide.
| Compound Name | 1-cyclopropylsulfonyl-N-[3-(difluoromethoxy)phenyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 71785615 |
| Molecular Formula | C14H16F2N2O4S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-cyclopropylsulfonyl-N-[3-(difluoromethoxy)phenyl]azetidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)C1CN(S(=O)(=O)C2CC2)C1 |
| InChI | InChI=1S/C14H16F2N2O4S/c15-14(16)22-11-3-1-2-10(6-11)17-13(19)9-7-18(8-9)23(20,21)12-4-5-12/h1-3,6,9,12,14H,4-5,7-8H2,(H,17,19) |
| InChIKey | HXNFOYIUXMRSEE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |