C19H17F3N2O4 — CID 71785377
N-[3-(difluoromethoxy)phenyl]-1-[2-(2-fluorophenoxy)acetyl]azetidine-3-carboxamide (PubChem CID 71785377) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-1-[2-(2-fluorophenoxy)acetyl]azetidine-3-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-1-[2-(2-fluorophenoxy)acetyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 71785377 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-1-[2-(2-fluorophenoxy)acetyl]azetidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)C1CN(C(=O)COc2ccccc2F)C1 |
| InChI | InChI=1S/C19H17F3N2O4/c20-15-6-1-2-7-16(15)27-11-17(25)24-9-12(10-24)18(26)23-13-4-3-5-14(8-13)28-19(21)22/h1-8,12,19H,9-11H2,(H,23,26) |
| InChIKey | NUPCWNBNXIOSOI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |