C18H24N2O5 — CID 90567907
N-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 90567907) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90567907 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(=O)N(C3CCOCC3)C2)cc1OC |
| InChI | InChI=1S/C18H24N2O5/c1-23-15-4-3-13(10-16(15)24-2)19-18(22)12-9-17(21)20(11-12)14-5-7-25-8-6-14/h3-4,10,12,14H,5-9,11H2,1-2H3,(H,19,22) |
| InChIKey | UAAVKFAMTDQEMA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |