C16H22N2O3 — CID 108865301
[3-(cycloheptylcarbamoylamino)phenyl] acetate (PubChem CID 108865301) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is [3-(cycloheptylcarbamoylamino)phenyl] acetate.
| Compound Name | [3-(cycloheptylcarbamoylamino)phenyl] acetate |
|---|---|
| PubChem CID | 108865301 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [3-(cycloheptylcarbamoylamino)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(NC(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-12(19)21-15-10-6-9-14(11-15)18-16(20)17-13-7-4-2-3-5-8-13/h6,9-11,13H,2-5,7-8H2,1H3,(H2,17,18,20) |
| InChIKey | MDOCVNFSSOVWJG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|