C20H33N3O3 — CID 3032075
1-[3-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea (PubChem CID 3032075) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[3-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea.
| Compound Name | 1-[3-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 3032075 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 1-[3-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea |
| SMILES | CC(C)(C)NCC(O)COc1cccc(NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C20H33N3O3/c1-20(2,3)21-13-17(24)14-26-18-11-7-10-16(12-18)23-19(25)22-15-8-5-4-6-9-15/h7,10-12,15,17,21,24H,4-6,8-9,13-14H2,1-3H3,(H2,22,23,25) |
| InChIKey | LKJIRFDSRUUAKE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |