C16H21F2N3O3 — CID 133129107
1-[3-(difluoromethoxy)phenyl]-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea (PubChem CID 133129107) has the molecular formula C16H21F2N3O3 and a molecular weight of 341.36 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea |
|---|---|
| PubChem CID | 133129107 |
| Molecular Formula | C16H21F2N3O3 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)N[C@@H]1COC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C16H21F2N3O3/c17-15(18)24-12-5-3-4-11(8-12)19-16(22)20-13-9-23-10-14(13)21-6-1-2-7-21/h3-5,8,13-15H,1-2,6-7,9-10H2,(H2,19,20,22)/t13-,14-/m1/s1 |
| InChIKey | JIMBMEKYSCKKCC-ZIAGYGMSSA-N |
| XLogP | 2.27 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |