C16H20F3N3O2 — CID 133134827
1-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-3-(2,3,5-trifluorophenyl)urea (PubChem CID 133134827) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-3-(2,3,5-trifluorophenyl)urea.
| Compound Name | 1-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-3-(2,3,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 133134827 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-3-(2,3,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)N[C@@H]1COC[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C16H20F3N3O2/c17-10-6-11(18)15(19)12(7-10)20-16(23)21-13-8-24-9-14(13)22-4-2-1-3-5-22/h6-7,13-14H,1-5,8-9H2,(H2,20,21,23)/t13-,14-/m1/s1 |
| InChIKey | UXXZZAHQDAPCOM-ZIAGYGMSSA-N |
| XLogP | 2.48 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|