C14H17F3N2O2 — CID 125177285
1-[2-[(3S)-oxan-3-yl]ethyl]-3-(2,3,5-trifluorophenyl)urea (PubChem CID 125177285) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-[2-[(3S)-oxan-3-yl]ethyl]-3-(2,3,5-trifluorophenyl)urea.
| Compound Name | 1-[2-[(3S)-oxan-3-yl]ethyl]-3-(2,3,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 125177285 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[2-[(3S)-oxan-3-yl]ethyl]-3-(2,3,5-trifluorophenyl)urea |
| SMILES | O=C(NCC[C@@H]1CCCOC1)Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C14H17F3N2O2/c15-10-6-11(16)13(17)12(7-10)19-14(20)18-4-3-9-2-1-5-21-8-9/h6-7,9H,1-5,8H2,(H2,18,19,20)/t9-/m0/s1 |
| InChIKey | PTTFHEYGQYSUTC-VIFPVBQESA-N |
| XLogP | 3.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|