C12H16F2N2O — CID 114129599
3,5-difluoro-1-N-[2-(oxolan-3-yl)ethyl]benzene-1,2-diamine (PubChem CID 114129599) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 3,5-difluoro-1-N-[2-(oxolan-3-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-[2-(oxolan-3-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 114129599 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3,5-difluoro-1-N-[2-(oxolan-3-yl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)cc1NCCC1CCOC1 |
| InChI | InChI=1S/C12H16F2N2O/c13-9-5-10(14)12(15)11(6-9)16-3-1-8-2-4-17-7-8/h5-6,8,16H,1-4,7,15H2 |
| InChIKey | QJFIWPAKUULSNM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|